About actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide
actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide (PubChem CID 59063084) has the molecular formula C14H29AcN2-
and a molecular weight of 452.40 g/mol. Its IUPAC name is actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide.
Molecular Properties
| Compound Name | actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide |
| PubChem CID | 59063084 |
| Molecular Formula | C14H29AcN2- |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide |
| SMILES | CCCC(CCC)C([NH-])[C@@H]1C[C@@H](C)C[C@H]1N.[Ac] |
| InChI | InChI=1S/C14H29N2.Ac/c1-4-6-11(7-5-2)14(16)12-8-10(3)9-13(12)15;/h10-14,16H,4-9,15H2,1-3H3;/q-1;/t10-,12-,13-,14?;/m1./s1 |
| InChIKey | RVACJRKBCICMCM-JORRANJBSA-N |
| XLogP | 4.00 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide?
The IUPAC name of actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide (CID 59063084) is actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide.
What is the SMILES notation for actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide?
The canonical SMILES for actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide is CCCC(CCC)C([NH-])[C@@H]1C[C@@H](C)C[C@H]1N.[Ac].
What is the InChIKey of actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide?
The InChIKey is RVACJRKBCICMCM-JORRANJBSA-N. The full InChI is InChI=1S/C14H29N2.Ac/c1-4-6-11(7-5-2)14(16)12-8-10(3)9-13(12)15;/h10-14,16H,4-9,15H2,1-3H3;/q-1;/t10-,12-,13-,14?;/m1./s1.
What are the key properties of actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide?
actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide has a molecular weight of 452.40 g/mol, XLogP of 4.00, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;[1-[(1S,2R,4R)-2-amino-4-methylcyclopentyl]-2-propylpentyl]azanide is sourced from PubChem (CID 59063084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).