C8H14N+ — CID 59063404
(6Z)-6-deuterio-1-methyl-2,3,4,5-tetrahydroazocin-1-ium (PubChem CID 59063404) has the molecular formula C8H14N+ and a molecular weight of 125.21 g/mol. Its IUPAC name is (6Z)-6-deuterio-1-methyl-2,3,4,5-tetrahydroazocin-1-ium.
| Compound Name | (6Z)-6-deuterio-1-methyl-2,3,4,5-tetrahydroazocin-1-ium |
|---|---|
| PubChem CID | 59063404 |
| Molecular Formula | C8H14N+ |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (6Z)-6-deuterio-1-methyl-2,3,4,5-tetrahydroazocin-1-ium |
| SMILES | [2H]/C1=C/C=[N+](/C)CCCC1 |
| InChI | InChI=1S/C8H14N/c1-9-7-5-3-2-4-6-8-9/h3,5,7H,2,4,6,8H2,1H3/q+1/b5-3-,9-7-/i3D |
| InChIKey | RXABZHJZVPJCQL-DJJYAGBMSA-N |
| XLogP | 1.44 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|