C22H18Cl3N2O7S2+ — CID 59063430
2-[2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichlorospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonate (PubChem CID 59063430) has the molecular formula C22H18Cl3N2O7S2+ and a molecular weight of 592.89 g/mol. Its IUPAC name is 2-[2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichlorospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonate.
| Compound Name | 2-[2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichlorospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonate |
|---|---|
| PubChem CID | 59063430 |
| Molecular Formula | C22H18Cl3N2O7S2+ |
| Molecular Weight | 592.89 g/mol |
| Exact Mass | 590.96 |
| IUPAC Name | 2-[2-[[1-(carboxymethyl)-5-chlorothieno[3,2-d][1,3]oxazol-1-ium-2-yl]methylidene]butylidene]-5,6-dichlorospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2'-sulfonate |
| SMILES | CCC(=Cc1oc2sc(Cl)cc2[n+]1CC(=O)O)C=C1Oc2cc(Cl)c(Cl)cc2[N+]12CCC2S(=O)(=O)[O-] |
| InChI | InChI=1S/C22H17Cl3N2O7S2/c1-2-11(5-18-26(10-21(28)29)14-9-17(25)35-22(14)34-18)6-19-27(4-3-20(27)36(30,31)32)15-7-12(23)13(24)8-16(15)33-19/h5-9,20H,2-4,10H2,1H3/p+1 |
| InChIKey | FTQVAKDVBOHDDL-UHFFFAOYSA-O |
| XLogP | 5.14 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.89 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|