C22H19Cl3N2O7S2+2 — CID 59063431
2-[5-chloro-2-[2-[(5,6-dichloro-2'-sulfospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2-ylidene)methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid (PubChem CID 59063431) has the molecular formula C22H19Cl3N2O7S2+2 and a molecular weight of 593.89 g/mol. Its IUPAC name is 2-[5-chloro-2-[2-[(5,6-dichloro-2'-sulfospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2-ylidene)methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-2-[2-[(5,6-dichloro-2'-sulfospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2-ylidene)methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 59063431 |
| Molecular Formula | C22H19Cl3N2O7S2+2 |
| Molecular Weight | 593.89 g/mol |
| Exact Mass | 591.97 |
| IUPAC Name | 2-[5-chloro-2-[2-[(5,6-dichloro-2'-sulfospiro[1,3-benzoxazol-3-ium-3,1'-azetidin-1-ium]-2-ylidene)methyl]but-1-enyl]thieno[3,2-d][1,3]oxazol-1-ium-1-yl]acetic acid |
| SMILES | CCC(=Cc1oc2sc(Cl)cc2[n+]1CC(=O)O)C=C1Oc2cc(Cl)c(Cl)cc2[N+]12CCC2S(=O)(=O)O |
| InChI | InChI=1S/C22H17Cl3N2O7S2/c1-2-11(5-18-26(10-21(28)29)14-9-17(25)35-22(14)34-18)6-19-27(4-3-20(27)36(30,31)32)15-7-12(23)13(24)8-16(15)33-19/h5-9,20H,2-4,10H2,1H3/p+2 |
| InChIKey | FTQVAKDVBOHDDL-UHFFFAOYSA-P |
| XLogP | 5.48 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|