C19H34O10P- — CID 59063471
[(1R,2R,4S)-2,3-dihydroxy-4-methyl-2-(propan-2-yloxymethyl)cyclopentyl] [(2S,3R,5S)-5-methyl-3-propan-2-yloxyoxolane-2-carbonyl] phosphate (PubChem CID 59063471) has the molecular formula C19H34O10P- and a molecular weight of 453.45 g/mol. Its IUPAC name is [(1R,2R,4S)-2,3-dihydroxy-4-methyl-2-(propan-2-yloxymethyl)cyclopentyl] [(2S,3R,5S)-5-methyl-3-propan-2-yloxyoxolane-2-carbonyl] phosphate.
| Compound Name | [(1R,2R,4S)-2,3-dihydroxy-4-methyl-2-(propan-2-yloxymethyl)cyclopentyl] [(2S,3R,5S)-5-methyl-3-propan-2-yloxyoxolane-2-carbonyl] phosphate |
|---|---|
| PubChem CID | 59063471 |
| Molecular Formula | C19H34O10P- |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | [(1R,2R,4S)-2,3-dihydroxy-4-methyl-2-(propan-2-yloxymethyl)cyclopentyl] [(2S,3R,5S)-5-methyl-3-propan-2-yloxyoxolane-2-carbonyl] phosphate |
| SMILES | CC(C)OC[C@@]1(O)C(O)[C@@H](C)C[C@H]1OP(=O)([O-])OC(=O)[C@H]1O[C@@H](C)C[C@H]1OC(C)C |
| InChI | InChI=1S/C19H35O10P/c1-10(2)25-9-19(22)15(7-12(5)17(19)20)28-30(23,24)29-18(21)16-14(26-11(3)4)8-13(6)27-16/h10-17,20,22H,7-9H2,1-6H3,(H,23,24)/p-1/t12-,13-,14+,15+,16-,17?,19-/m0/s1 |
| InChIKey | KEZFCTHGXLQPOP-SRROXZAASA-M |
| XLogP | 0.91 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|