About CID 59063508
CID 59063508 (PubChem CID 59063508) has the molecular formula C16H28B2O6PS2-
and a molecular weight of 433.13 g/mol.
Molecular Properties
| Compound Name | CID 59063508 |
| PubChem CID | 59063508 |
| Molecular Formula | C16H28B2O6PS2- |
| Molecular Weight | 433.13 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | — |
| SMILES | [B][C@H]1C[C@@H](OC(C)C)[C@@H](CSP(=O)([O-])S[C@@H]2C[C@H]([B])O[C@@H]2COC(C)C)O1 |
| InChI | InChI=1S/C16H29B2O6PS2/c1-9(2)21-7-12-14(6-16(18)23-12)27-25(19,20)26-8-13-11(22-10(3)4)5-15(17)24-13/h9-16H,5-8H2,1-4H3,(H,19,20)/p-1/t11-,12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | VPJIUMUJNJWUNV-VUVWGQCBSA-M |
| XLogP | 2.08 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.13 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 59063508 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59063508?
The IUPAC name of CID 59063508 (CID 59063508) is not available.
What is the SMILES notation for CID 59063508?
The canonical SMILES for CID 59063508 is [B][C@H]1C[C@@H](OC(C)C)[C@@H](CSP(=O)([O-])S[C@@H]2C[C@H]([B])O[C@@H]2COC(C)C)O1.
What is the InChIKey of CID 59063508?
The InChIKey is VPJIUMUJNJWUNV-VUVWGQCBSA-M. The full InChI is InChI=1S/C16H29B2O6PS2/c1-9(2)21-7-12-14(6-16(18)23-12)27-25(19,20)26-8-13-11(22-10(3)4)5-15(17)24-13/h9-16H,5-8H2,1-4H3,(H,19,20)/p-1/t11-,12-,13-,14-,15-,16-/m1/s1.
What are the key properties of CID 59063508?
CID 59063508 has a molecular weight of 433.13 g/mol, XLogP of 2.08, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59063508 is sourced from PubChem (CID 59063508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).