About (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide
(2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide (PubChem CID 59063633) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide |
| PubChem CID | 59063633 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C10H20N2O3/c1-6(2)3-7(11)10(14)12-8-4-15-5-9(8)13/h6-9,13H,3-5,11H2,1-2H3,(H,12,14)/t7-,8-,9-/m0/s1 |
| InChIKey | CJWLXZSJAFLPJR-CIUDSAMLSA-N |
| XLogP | -0.76 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide?
The IUPAC name of (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide (CID 59063633) is (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide.
What is the SMILES notation for (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide?
The canonical SMILES for (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide is CC(C)C[C@H](N)C(=O)N[C@H]1COC[C@@H]1O.
What is the InChIKey of (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide?
The InChIKey is CJWLXZSJAFLPJR-CIUDSAMLSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-6(2)3-7(11)10(14)12-8-4-15-5-9(8)13/h6-9,13H,3-5,11H2,1-2H3,(H,12,14)/t7-,8-,9-/m0/s1.
What are the key properties of (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide?
(2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide has a molecular weight of 216.28 g/mol, XLogP of -0.76, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[(3S,4R)-4-hydroxyoxolan-3-yl]-4-methylpentanamide is sourced from PubChem (CID 59063633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).