C40H44N2Zr — CID 59063833
[2,6-di(propan-2-yl)phenyl]-(1-pyridin-2-ylethenyl)azanide;methanidylbenzene;zirconium(4+) (PubChem CID 59063833) has the molecular formula C40H44N2Zr and a molecular weight of 644.03 g/mol. Its IUPAC name is [2,6-di(propan-2-yl)phenyl]-(1-pyridin-2-ylethenyl)azanide;methanidylbenzene;zirconium(4+).
| Compound Name | [2,6-di(propan-2-yl)phenyl]-(1-pyridin-2-ylethenyl)azanide;methanidylbenzene;zirconium(4+) |
|---|---|
| PubChem CID | 59063833 |
| Molecular Formula | C40H44N2Zr |
| Molecular Weight | 644.03 g/mol |
| Exact Mass | 642.26 |
| IUPAC Name | [2,6-di(propan-2-yl)phenyl]-(1-pyridin-2-ylethenyl)azanide;methanidylbenzene;zirconium(4+) |
| SMILES | C=C([N-]c1c(C(C)C)cccc1C(C)C)c1ccccn1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[Zr+4] |
| InChI | InChI=1S/C19H23N2.3C7H7.Zr/c1-13(2)16-9-8-10-17(14(3)4)19(16)21-15(5)18-11-6-7-12-20-18;3*1-7-5-3-2-4-6-7;/h6-14H,5H2,1-4H3;3*2-6H,1H2;/q4*-1;+4 |
| InChIKey | VNWMXNLDZUOODB-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.03 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|