C7H16O5 — CID 59064032
(2R,3S,4R,5R)-5-methylhexane-1,2,3,4,6-pentol (PubChem CID 59064032) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-methylhexane-1,2,3,4,6-pentol.
| Compound Name | (2R,3S,4R,5R)-5-methylhexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 59064032 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2R,3S,4R,5R)-5-methylhexane-1,2,3,4,6-pentol |
| SMILES | C[C@H](CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H16O5/c1-4(2-8)6(11)7(12)5(10)3-9/h4-12H,2-3H2,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | XIFXBRJBPNACTD-DBRKOABJSA-N |
| XLogP | -2.31 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |