C41H40FNO5 — CID 59064098
6-[2-fluoro-4-[(2S)-2-[hydroxy(dinaphthalen-1-yl)methyl]pyrrolidine-1-carbonyl]phenoxy]hexyl prop-2-enoate (PubChem CID 59064098) has the molecular formula C41H40FNO5 and a molecular weight of 645.77 g/mol. Its IUPAC name is 6-[2-fluoro-4-[(2S)-2-[hydroxy(dinaphthalen-1-yl)methyl]pyrrolidine-1-carbonyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[2-fluoro-4-[(2S)-2-[hydroxy(dinaphthalen-1-yl)methyl]pyrrolidine-1-carbonyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 59064098 |
| Molecular Formula | C41H40FNO5 |
| Molecular Weight | 645.77 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | 6-[2-fluoro-4-[(2S)-2-[hydroxy(dinaphthalen-1-yl)methyl]pyrrolidine-1-carbonyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)N2CCC[C@H]2C(O)(c2cccc3ccccc23)c2cccc3ccccc23)cc1F |
| InChI | InChI=1S/C41H40FNO5/c1-2-39(44)48-27-10-4-3-9-26-47-37-24-23-31(28-36(37)42)40(45)43-25-13-22-38(43)41(46,34-20-11-16-29-14-5-7-18-32(29)34)35-21-12-17-30-15-6-8-19-33(30)35/h2,5-8,11-12,14-21,23-24,28,38,46H,1,3-4,9-10,13,22,25-27H2/t38-/m0/s1 |
| InChIKey | OYZLLNJMLJQGED-LHEWISCISA-N |
| XLogP | 8.34 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.77 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|