About 2,5-dichloropyrimidine
2,5-dichloropyrimidine (PubChem CID 590641) has the molecular formula C4H2Cl2N2
and a molecular weight of 148.98 g/mol. Its IUPAC name is 2,5-dichloropyrimidine.
Molecular Properties
| Compound Name | 2,5-dichloropyrimidine |
| PubChem CID | 590641 |
| Molecular Formula | C4H2Cl2N2 |
| Molecular Weight | 148.98 g/mol |
| Exact Mass | 147.96 |
| IUPAC Name | 2,5-dichloropyrimidine |
| SMILES | Clc1cnc(Cl)nc1 |
| InChI | InChI=1S/C4H2Cl2N2/c5-3-1-7-4(6)8-2-3/h1-2H |
| InChIKey | CEJAHXLRNZJPQH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.98 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloropyrimidine?
The IUPAC name of 2,5-dichloropyrimidine (CID 590641) is 2,5-dichloropyrimidine.
What is the SMILES notation for 2,5-dichloropyrimidine?
The canonical SMILES for 2,5-dichloropyrimidine is Clc1cnc(Cl)nc1.
What is the InChIKey of 2,5-dichloropyrimidine?
The InChIKey is CEJAHXLRNZJPQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2Cl2N2/c5-3-1-7-4(6)8-2-3/h1-2H.
What are the key properties of 2,5-dichloropyrimidine?
2,5-dichloropyrimidine has a molecular weight of 148.98 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloropyrimidine is sourced from PubChem (CID 590641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).