About N-butylethanimine oxide
N-butylethanimine oxide (PubChem CID 59064396) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is N-butylethanimine oxide.
Molecular Properties
| Compound Name | N-butylethanimine oxide |
| PubChem CID | 59064396 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | N-butylethanimine oxide |
| SMILES | C/C=[N+](/[O-])CCCC |
| InChI | InChI=1S/C6H13NO/c1-3-5-6-7(8)4-2/h4H,3,5-6H2,1-2H3/b7-4+ |
| InChIKey | LBTOXGDBSUPQIJ-QPJJXVBHSA-N |
| XLogP | 1.39 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-butylethanimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylethanimine oxide?
The IUPAC name of N-butylethanimine oxide (CID 59064396) is N-butylethanimine oxide.
What is the SMILES notation for N-butylethanimine oxide?
The canonical SMILES for N-butylethanimine oxide is C/C=[N+](/[O-])CCCC.
What is the InChIKey of N-butylethanimine oxide?
The InChIKey is LBTOXGDBSUPQIJ-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H13NO/c1-3-5-6-7(8)4-2/h4H,3,5-6H2,1-2H3/b7-4+.
What are the key properties of N-butylethanimine oxide?
N-butylethanimine oxide has a molecular weight of 115.18 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylethanimine oxide is sourced from PubChem (CID 59064396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).