C22H30N4O6S — CID 59064636
methyl 2-methyl-4-[2-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxycarbamoyl]benzoate (PubChem CID 59064636) has the molecular formula C22H30N4O6S and a molecular weight of 478.57 g/mol. Its IUPAC name is methyl 2-methyl-4-[2-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxycarbamoyl]benzoate.
| Compound Name | methyl 2-methyl-4-[2-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxycarbamoyl]benzoate |
|---|---|
| PubChem CID | 59064636 |
| Molecular Formula | C22H30N4O6S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | methyl 2-methyl-4-[2-[5-[(4R)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxycarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NOCCNC(=O)CCCC[C@H]2SCC3NC(=O)NC32)cc1C |
| InChI | InChI=1S/C22H30N4O6S/c1-13-11-14(7-8-15(13)21(29)31-2)20(28)26-32-10-9-23-18(27)6-4-3-5-17-19-16(12-33-17)24-22(30)25-19/h7-8,11,16-17,19H,3-6,9-10,12H2,1-2H3,(H,23,27)(H,26,28)(H2,24,25,30)/t16?,17-,19?/m1/s1 |
| InChIKey | AIXVLIGQYAJXIF-TVRKMHQQSA-N |
| XLogP | 1.29 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|