C38H60N8O8 — CID 59064994
3-[[4-amino-2-[[2-[[2-(decanoylamino)-5-(methylamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid (PubChem CID 59064994) has the molecular formula C38H60N8O8 and a molecular weight of 756.95 g/mol. Its IUPAC name is 3-[[4-amino-2-[[2-[[2-(decanoylamino)-5-(methylamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid.
| Compound Name | 3-[[4-amino-2-[[2-[[2-(decanoylamino)-5-(methylamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 59064994 |
| Molecular Formula | C38H60N8O8 |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.45 |
| IUPAC Name | 3-[[4-amino-2-[[2-[[2-(decanoylamino)-5-(methylamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid |
| SMILES | CCCCCCCCCC(=O)NC(CCCNC)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(=O)NC(C)C |
| InChI | InChI=1S/C38H60N8O8/c1-5-6-7-8-9-10-11-18-33(48)43-28(17-14-19-40-4)35(51)44-29(20-25-23-41-27-16-13-12-15-26(25)27)37(53)45-30(21-32(39)47)38(54)46-31(22-34(49)50)36(52)42-24(2)3/h12-13,15-16,23-24,28-31,40-41H,5-11,14,17-22H2,1-4H3,(H2,39,47)(H,42,52)(H,43,48)(H,44,51)(H,45,53)(H,46,54)(H,49,50) |
| InChIKey | SZAGSGPMWJYVHQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 253.71 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|