C26H45N5O7 — CID 59065092
3-[[4-amino-2-[(1-decanoylpyrrolidine-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid (PubChem CID 59065092) has the molecular formula C26H45N5O7 and a molecular weight of 539.67 g/mol. Its IUPAC name is 3-[[4-amino-2-[(1-decanoylpyrrolidine-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid.
| Compound Name | 3-[[4-amino-2-[(1-decanoylpyrrolidine-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 59065092 |
| Molecular Formula | C26H45N5O7 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | 3-[[4-amino-2-[(1-decanoylpyrrolidine-2-carbonyl)amino]-4-oxobutanoyl]amino]-4-oxo-4-(propan-2-ylamino)butanoic acid |
| SMILES | CCCCCCCCCC(=O)N1CCCC1C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(=O)NC(C)C |
| InChI | InChI=1S/C26H45N5O7/c1-4-5-6-7-8-9-10-13-22(33)31-14-11-12-20(31)26(38)30-18(15-21(27)32)25(37)29-19(16-23(34)35)24(36)28-17(2)3/h17-20H,4-16H2,1-3H3,(H2,27,32)(H,28,36)(H,29,37)(H,30,38)(H,34,35) |
| InChIKey | NPUBVSIGBMTATG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 188.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|