C10H19N3O4 — CID 59065134
(2S,3R,4S,5S,6S)-5-azido-2-tert-butyl-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 59065134) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-5-azido-2-tert-butyl-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4S,5S,6S)-5-azido-2-tert-butyl-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 59065134 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (2S,3R,4S,5S,6S)-5-azido-2-tert-butyl-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC(C)(C)[C@@H]1O[C@H](CO)[C@@H](N=[N+]=[N-])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H19N3O4/c1-10(2,3)9-8(16)7(15)6(12-13-11)5(4-14)17-9/h5-9,14-16H,4H2,1-3H3/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | VSRQWQYOBQYNOL-SYHAXYEDSA-N |
| XLogP | 0.19 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|