C11H21FO2 — CID 59065137
(2S,3R,4S,6S)-2-tert-butyl-6-(fluoromethyl)-4-methyloxan-3-ol (PubChem CID 59065137) has the molecular formula C11H21FO2 and a molecular weight of 204.28 g/mol. Its IUPAC name is (2S,3R,4S,6S)-2-tert-butyl-6-(fluoromethyl)-4-methyloxan-3-ol.
| Compound Name | (2S,3R,4S,6S)-2-tert-butyl-6-(fluoromethyl)-4-methyloxan-3-ol |
|---|---|
| PubChem CID | 59065137 |
| Molecular Formula | C11H21FO2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2S,3R,4S,6S)-2-tert-butyl-6-(fluoromethyl)-4-methyloxan-3-ol |
| SMILES | C[C@H]1C[C@@H](CF)O[C@@H](C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C11H21FO2/c1-7-5-8(6-12)14-10(9(7)13)11(2,3)4/h7-10,13H,5-6H2,1-4H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | RQGYIHWMIDJNEJ-AXTSPUMRSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |