C26H19F2N3O6 — CID 59065155
3-[(2R,3R,4R,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,19-difluoro-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 59065155) has the molecular formula C26H19F2N3O6 and a molecular weight of 507.45 g/mol. Its IUPAC name is 3-[(2R,3R,4R,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,19-difluoro-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 3-[(2R,3R,4R,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,19-difluoro-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 59065155 |
| Molecular Formula | C26H19F2N3O6 |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 3-[(2R,3R,4R,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-7,19-difluoro-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3cc(F)ccc3[nH]c1c1c2c2cc(F)ccc2n1[C@@H]1O[C@H](CO)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H19F2N3O6/c27-9-1-3-14-12(5-9)17-19-20(25(36)30-24(19)35)18-13-6-10(28)2-4-15(13)31(22(18)21(17)29-14)26-23(34)16(33)7-11(8-32)37-26/h1-6,11,16,23,26,29,32-34H,7-8H2,(H,30,35,36)/t11-,16+,23+,26+/m0/s1 |
| InChIKey | WYOBRVDVMXTHJA-SPBKGTFSSA-N |
| XLogP | 2.59 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|