C10H18FN3O3 — CID 59065173
(2S,3R,4R,5S,6S)-5-azido-2-tert-butyl-6-(fluoromethyl)oxane-3,4-diol (PubChem CID 59065173) has the molecular formula C10H18FN3O3 and a molecular weight of 247.27 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-5-azido-2-tert-butyl-6-(fluoromethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,5S,6S)-5-azido-2-tert-butyl-6-(fluoromethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 59065173 |
| Molecular Formula | C10H18FN3O3 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (2S,3R,4R,5S,6S)-5-azido-2-tert-butyl-6-(fluoromethyl)oxane-3,4-diol |
| SMILES | CC(C)(C)[C@@H]1O[C@H](CF)[C@@H](N=[N+]=[N-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H18FN3O3/c1-10(2,3)9-8(16)7(15)6(13-14-12)5(4-11)17-9/h5-9,15-16H,4H2,1-3H3/t5-,6-,7-,8-,9-/m1/s1 |
| InChIKey | UVOUNMGTNLRINT-JGKVKWKGSA-N |
| XLogP | 1.17 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|