C25H31NO — CID 59065249
(NE)-N-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-prop-2-enylphenyl]methylidene]hydroxylamine (PubChem CID 59065249) has the molecular formula C25H31NO and a molecular weight of 361.53 g/mol. Its IUPAC name is (NE)-N-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-prop-2-enylphenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-prop-2-enylphenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59065249 |
| Molecular Formula | C25H31NO |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (NE)-N-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-prop-2-enylphenyl]methylidene]hydroxylamine |
| SMILES | C=CCc1ccc(/C=N/O)cc1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H31NO/c1-7-8-19-10-9-18(16-26-27)14-21(19)20-15-23-22(13-17(20)2)24(3,4)11-12-25(23,5)6/h7,9-10,13-16,27H,1,8,11-12H2,2-6H3/b26-16+ |
| InChIKey | CIXRSGDYGQATEA-WGOQTCKBSA-N |
| XLogP | 6.55 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|