C24H28F3NO — CID 59065253
(NE)-N-[[4-ethyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine (PubChem CID 59065253) has the molecular formula C24H28F3NO and a molecular weight of 403.49 g/mol. Its IUPAC name is (NE)-N-[[4-ethyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-ethyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59065253 |
| Molecular Formula | C24H28F3NO |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | (NE)-N-[[4-ethyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine |
| SMILES | CCc1ccc(/C=N/O)cc1-c1cc2c(cc1C(F)(F)F)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H28F3NO/c1-6-16-8-7-15(14-28-29)11-17(16)18-12-20-21(13-19(18)24(25,26)27)23(4,5)10-9-22(20,2)3/h7-8,11-14,29H,6,9-10H2,1-5H3/b28-14+ |
| InChIKey | XYLRFNKEHIWQAK-CCVNUDIWSA-N |
| XLogP | 7.09 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|