C22H26ClNO — CID 59065255
(NE)-N-[[4-chloro-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine (PubChem CID 59065255) has the molecular formula C22H26ClNO and a molecular weight of 355.91 g/mol. Its IUPAC name is (NE)-N-[[4-chloro-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-chloro-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59065255 |
| Molecular Formula | C22H26ClNO |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | (NE)-N-[[4-chloro-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine |
| SMILES | Cc1cc2c(cc1-c1cc(/C=N/O)ccc1Cl)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H26ClNO/c1-14-10-18-19(22(4,5)9-8-21(18,2)3)12-16(14)17-11-15(13-24-25)6-7-20(17)23/h6-7,10-13,25H,8-9H2,1-5H3/b24-13+ |
| InChIKey | MJJQKZIHWFBMFP-ZMOGYAJESA-N |
| XLogP | 6.47 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|