C23H27F2NO2 — CID 59065256
(NE)-N-[[2,6-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine (PubChem CID 59065256) has the molecular formula C23H27F2NO2 and a molecular weight of 387.47 g/mol. Its IUPAC name is (NE)-N-[[2,6-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2,6-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59065256 |
| Molecular Formula | C23H27F2NO2 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (NE)-N-[[2,6-difluoro-4-methoxy-3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]hydroxylamine |
| SMILES | COc1cc(F)c(/C=N/O)c(F)c1-c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H27F2NO2/c1-13-9-16-17(23(4,5)8-7-22(16,2)3)10-14(13)20-19(28-6)11-18(24)15(12-26-27)21(20)25/h9-12,27H,7-8H2,1-6H3/b26-12+ |
| InChIKey | JZILKRQEULGRJR-RPPGKUMJSA-N |
| XLogP | 6.11 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|