C30H32F3NO3 — CID 59065257
(NE)-N-[[4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methoxy]phenyl]methylidene]hydroxylamine (PubChem CID 59065257) has the molecular formula C30H32F3NO3 and a molecular weight of 511.58 g/mol. Its IUPAC name is (NE)-N-[[4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methoxy]phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methoxy]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59065257 |
| Molecular Formula | C30H32F3NO3 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (NE)-N-[[4-[[3-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-4-(trifluoromethoxy)phenyl]methoxy]phenyl]methylidene]hydroxylamine |
| SMILES | Cc1cc2c(cc1-c1cc(COc3ccc(/C=N/O)cc3)ccc1OC(F)(F)F)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H32F3NO3/c1-19-14-25-26(29(4,5)13-12-28(25,2)3)16-23(19)24-15-21(8-11-27(24)37-30(31,32)33)18-36-22-9-6-20(7-10-22)17-34-35/h6-11,14-17,35H,12-13,18H2,1-5H3/b34-17+ |
| InChIKey | CIZJGTLKKMJFPI-KVAAJVFYSA-N |
| XLogP | 8.30 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|