C23H26F3NO — CID 59065287
(NE)-N-[[4-methyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine (PubChem CID 59065287) has the molecular formula C23H26F3NO and a molecular weight of 389.46 g/mol. Its IUPAC name is (NE)-N-[[4-methyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[4-methyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 59065287 |
| Molecular Formula | C23H26F3NO |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (NE)-N-[[4-methyl-3-[5,5,8,8-tetramethyl-3-(trifluoromethyl)-6,7-dihydronaphthalen-2-yl]phenyl]methylidene]hydroxylamine |
| SMILES | Cc1ccc(/C=N/O)cc1-c1cc2c(cc1C(F)(F)F)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H26F3NO/c1-14-6-7-15(13-27-28)10-16(14)17-11-19-20(12-18(17)23(24,25)26)22(4,5)9-8-21(19,2)3/h6-7,10-13,28H,8-9H2,1-5H3/b27-13+ |
| InChIKey | YJQOPQNLRXTELA-UVHMKAGCSA-N |
| XLogP | 6.84 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|