C28H46O11 — CID 59065348
methyl 6-(3,3-dimethyl-2-oxobutoxy)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate (PubChem CID 59065348) has the molecular formula C28H46O11 and a molecular weight of 558.67 g/mol. Its IUPAC name is methyl 6-(3,3-dimethyl-2-oxobutoxy)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate.
| Compound Name | methyl 6-(3,3-dimethyl-2-oxobutoxy)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 59065348 |
| Molecular Formula | C28H46O11 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | methyl 6-(3,3-dimethyl-2-oxobutoxy)-3,4,5-tris(2,2-dimethylpropanoyloxy)oxane-2-carboxylate |
| SMILES | COC(=O)C1OC(OCC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C28H46O11/c1-25(2,3)15(29)14-35-21-19(39-24(33)28(10,11)12)17(38-23(32)27(7,8)9)16(18(36-21)20(30)34-13)37-22(31)26(4,5)6/h16-19,21H,14H2,1-13H3 |
| InChIKey | SIOGJAXQARBMFW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|