C20H21BrClNOS — CID 59065607
3-bromo-N-[2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxyethyl]-N-methylpropan-1-amine (PubChem CID 59065607) has the molecular formula C20H21BrClNOS and a molecular weight of 438.82 g/mol. Its IUPAC name is 3-bromo-N-[2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxyethyl]-N-methylpropan-1-amine.
| Compound Name | 3-bromo-N-[2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxyethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 59065607 |
| Molecular Formula | C20H21BrClNOS |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 3-bromo-N-[2-(3-chlorobenzo[b][1]benzothiepin-5-yl)oxyethyl]-N-methylpropan-1-amine |
| SMILES | CN(CCCBr)CCOC1=Cc2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H21BrClNOS/c1-23(10-4-9-21)11-12-24-18-13-15-5-2-3-6-19(15)25-20-8-7-16(22)14-17(18)20/h2-3,5-8,13-14H,4,9-12H2,1H3 |
| InChIKey | KNTAVJKBBGRTSX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|