About 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid
3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 59066206) has the molecular formula C22H15F3N2O3S
and a molecular weight of 444.43 g/mol. Its IUPAC name is 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
| PubChem CID | 59066206 |
| Molecular Formula | C22H15F3N2O3S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | CC(=O)c1cnc(-c2c(C(=O)O)n(Cc3cccc(C(F)(F)F)c3)c3ccccc23)s1 |
| InChI | InChI=1S/C22H15F3N2O3S/c1-12(28)17-10-26-20(31-17)18-15-7-2-3-8-16(15)27(19(18)21(29)30)11-13-5-4-6-14(9-13)22(23,24)25/h2-10H,11H2,1H3,(H,29,30) |
| InChIKey | WCVBHITUXHVNGU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid?
The IUPAC name of 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid (CID 59066206) is 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid.
What is the SMILES notation for 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid?
The canonical SMILES for 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid is CC(=O)c1cnc(-c2c(C(=O)O)n(Cc3cccc(C(F)(F)F)c3)c3ccccc23)s1.
What is the InChIKey of 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid?
The InChIKey is WCVBHITUXHVNGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O3S/c1-12(28)17-10-26-20(31-17)18-15-7-2-3-8-16(15)27(19(18)21(29)30)11-13-5-4-6-14(9-13)22(23,24)25/h2-10H,11H2,1H3,(H,29,30).
What are the key properties of 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid?
3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid has a molecular weight of 444.43 g/mol, XLogP of 5.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-acetyl-1,3-thiazol-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid is sourced from PubChem (CID 59066206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).