C15H25NO4 — CID 59066405
(3S)-3-(cyclohexylmethyl)-4-hydroxy-1-morpholin-4-ylbutane-1,2-dione (PubChem CID 59066405) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3S)-3-(cyclohexylmethyl)-4-hydroxy-1-morpholin-4-ylbutane-1,2-dione.
| Compound Name | (3S)-3-(cyclohexylmethyl)-4-hydroxy-1-morpholin-4-ylbutane-1,2-dione |
|---|---|
| PubChem CID | 59066405 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (3S)-3-(cyclohexylmethyl)-4-hydroxy-1-morpholin-4-ylbutane-1,2-dione |
| SMILES | O=C(C(=O)N1CCOCC1)[C@H](CO)CC1CCCCC1 |
| InChI | InChI=1S/C15H25NO4/c17-11-13(10-12-4-2-1-3-5-12)14(18)15(19)16-6-8-20-9-7-16/h12-13,17H,1-11H2/t13-/m0/s1 |
| InChIKey | YDWGRSPLQRBQDX-ZDUSSCGKSA-N |
| XLogP | 0.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|