About actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one
actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one (PubChem CID 59066609) has the molecular formula C7H10AcO3
and a molecular weight of 369.15 g/mol. Its IUPAC name is actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one |
| PubChem CID | 59066609 |
| Molecular Formula | C7H10AcO3 |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one |
| SMILES | CC1=COC(CO)CC1=O.[Ac] |
| InChI | InChI=1S/C7H10O3.Ac/c1-5-4-10-6(3-8)2-7(5)9;/h4,6,8H,2-3H2,1H3; |
| InChIKey | IBLOEUFDLGXCJP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one?
The IUPAC name of actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one (CID 59066609) is actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one.
What is the SMILES notation for actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one?
The canonical SMILES for actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one is CC1=COC(CO)CC1=O.[Ac].
What is the InChIKey of actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one?
The InChIKey is IBLOEUFDLGXCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.Ac/c1-5-4-10-6(3-8)2-7(5)9;/h4,6,8H,2-3H2,1H3;.
What are the key properties of actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one?
actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one has a molecular weight of 369.15 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;2-(hydroxymethyl)-5-methyl-2,3-dihydropyran-4-one is sourced from PubChem (CID 59066609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).