C42H55N5O4 — CID 59066880
(2,4,6-trimethylcyclohexyl) 2-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 59066880) has the molecular formula C42H55N5O4 and a molecular weight of 693.93 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 59066880 |
| Molecular Formula | C42H55N5O4 |
| Molecular Weight | 693.93 g/mol |
| Exact Mass | 693.43 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3cccc(NC(=O)C(CC)Oc4ccc(C(C)(C)CC)cc4C(C)(C)CC)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C42H55N5O4/c1-12-33(50-34-19-18-29(41(7,8)13-2)23-31(34)42(9,10)14-3)39(48)44-30-17-15-16-28(22-30)37-45-38-35(32(43-11)24-47(38)46-37)40(49)51-36-26(5)20-25(4)21-27(36)6/h15-19,22-27,33,36H,12-14,20-21H2,1-10H3,(H,44,48)(H,45,46) |
| InChIKey | UXWBYENBGKBWPS-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.93 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|