C34H49FO8S — CID 59067565
2-oxodec-6-en-4-yl 3-[3-[5-[(4-fluorophenyl)methylsulfanyl]-3-methoxypentanoyl]oxybutanoyloxy]hept-5-enoate (PubChem CID 59067565) has the molecular formula C34H49FO8S and a molecular weight of 636.82 g/mol. Its IUPAC name is 2-oxodec-6-en-4-yl 3-[3-[5-[(4-fluorophenyl)methylsulfanyl]-3-methoxypentanoyl]oxybutanoyloxy]hept-5-enoate.
| Compound Name | 2-oxodec-6-en-4-yl 3-[3-[5-[(4-fluorophenyl)methylsulfanyl]-3-methoxypentanoyl]oxybutanoyloxy]hept-5-enoate |
|---|---|
| PubChem CID | 59067565 |
| Molecular Formula | C34H49FO8S |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.31 |
| IUPAC Name | 2-oxodec-6-en-4-yl 3-[3-[5-[(4-fluorophenyl)methylsulfanyl]-3-methoxypentanoyl]oxybutanoyloxy]hept-5-enoate |
| SMILES | CC=CCC(CC(=O)OC(CC=CCCC)CC(C)=O)OC(=O)CC(C)OC(=O)CC(CCSCc1ccc(F)cc1)OC |
| InChI | InChI=1S/C34H49FO8S/c1-6-8-10-11-13-30(20-25(3)36)42-34(39)23-31(12-9-7-2)43-32(37)21-26(4)41-33(38)22-29(40-5)18-19-44-24-27-14-16-28(35)17-15-27/h7,9-11,14-17,26,29-31H,6,8,12-13,18-24H2,1-5H3 |
| InChIKey | ASKKJZTULJGRJZ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|