About (5S)-1,5-ditert-butylpyrrolidin-3-ol
(5S)-1,5-ditert-butylpyrrolidin-3-ol (PubChem CID 59067592) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is (5S)-1,5-ditert-butylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | (5S)-1,5-ditert-butylpyrrolidin-3-ol |
| PubChem CID | 59067592 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (5S)-1,5-ditert-butylpyrrolidin-3-ol |
| SMILES | CC(C)(C)[C@@H]1CC(O)CN1C(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-11(2,3)10-7-9(14)8-13(10)12(4,5)6/h9-10,14H,7-8H2,1-6H3/t9?,10-/m0/s1 |
| InChIKey | PSZBQTUHZSICDC-AXDSSHIGSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-1,5-ditert-butylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1,5-ditert-butylpyrrolidin-3-ol?
The IUPAC name of (5S)-1,5-ditert-butylpyrrolidin-3-ol (CID 59067592) is (5S)-1,5-ditert-butylpyrrolidin-3-ol.
What is the SMILES notation for (5S)-1,5-ditert-butylpyrrolidin-3-ol?
The canonical SMILES for (5S)-1,5-ditert-butylpyrrolidin-3-ol is CC(C)(C)[C@@H]1CC(O)CN1C(C)(C)C.
What is the InChIKey of (5S)-1,5-ditert-butylpyrrolidin-3-ol?
The InChIKey is PSZBQTUHZSICDC-AXDSSHIGSA-N. The full InChI is InChI=1S/C12H25NO/c1-11(2,3)10-7-9(14)8-13(10)12(4,5)6/h9-10,14H,7-8H2,1-6H3/t9?,10-/m0/s1.
What are the key properties of (5S)-1,5-ditert-butylpyrrolidin-3-ol?
(5S)-1,5-ditert-butylpyrrolidin-3-ol has a molecular weight of 199.34 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1,5-ditert-butylpyrrolidin-3-ol is sourced from PubChem (CID 59067592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).