About 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol
4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol (PubChem CID 59067602) has the molecular formula C13H19NOS2
and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol.
Molecular Properties
| Compound Name | 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol |
| PubChem CID | 59067602 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol |
| SMILES | C[C@@H](N)Cc1ccc(O)c(C2SCCCS2)c1 |
| InChI | InChI=1S/C13H19NOS2/c1-9(14)7-10-3-4-12(15)11(8-10)13-16-5-2-6-17-13/h3-4,8-9,13,15H,2,5-7,14H2,1H3/t9-/m1/s1 |
| InChIKey | SXIFICZOTVIYGW-SECBINFHSA-N |
| XLogP | 3.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol?
The IUPAC name of 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol (CID 59067602) is 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol.
What is the SMILES notation for 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol?
The canonical SMILES for 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol is C[C@@H](N)Cc1ccc(O)c(C2SCCCS2)c1.
What is the InChIKey of 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol?
The InChIKey is SXIFICZOTVIYGW-SECBINFHSA-N. The full InChI is InChI=1S/C13H19NOS2/c1-9(14)7-10-3-4-12(15)11(8-10)13-16-5-2-6-17-13/h3-4,8-9,13,15H,2,5-7,14H2,1H3/t9-/m1/s1.
What are the key properties of 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol?
4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol has a molecular weight of 269.43 g/mol, XLogP of 3.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-2-aminopropyl]-2-(1,3-dithian-2-yl)phenol is sourced from PubChem (CID 59067602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).