C15H24N2O3 — CID 59067677
1,6-ditert-butyl-3,3a,4,7a-tetrahydropyrrolo[2,3-c]pyridine-2,5,7-trione (PubChem CID 59067677) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1,6-ditert-butyl-3,3a,4,7a-tetrahydropyrrolo[2,3-c]pyridine-2,5,7-trione.
| Compound Name | 1,6-ditert-butyl-3,3a,4,7a-tetrahydropyrrolo[2,3-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 59067677 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1,6-ditert-butyl-3,3a,4,7a-tetrahydropyrrolo[2,3-c]pyridine-2,5,7-trione |
| SMILES | CC(C)(C)N1C(=O)CC2CC(=O)N(C(C)(C)C)C2C1=O |
| InChI | InChI=1S/C15H24N2O3/c1-14(2,3)16-10(18)7-9-8-11(19)17(15(4,5)6)13(20)12(9)16/h9,12H,7-8H2,1-6H3 |
| InChIKey | DWULUQMHQUIPDR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|