C15H28N2O — CID 59067685
1,6-ditert-butyl-2,3,3a,4,5,7a-hexahydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 59067685) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1,6-ditert-butyl-2,3,3a,4,5,7a-hexahydropyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 1,6-ditert-butyl-2,3,3a,4,5,7a-hexahydropyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 59067685 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1,6-ditert-butyl-2,3,3a,4,5,7a-hexahydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | CC(C)(C)N1CCC2CCN(C(C)(C)C)C2C1=O |
| InChI | InChI=1S/C15H28N2O/c1-14(2,3)16-9-7-11-8-10-17(15(4,5)6)13(18)12(11)16/h11-12H,7-10H2,1-6H3 |
| InChIKey | LTJWBQDUPOBLTL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |