C19H15N3O4 — CID 59068196
3-(2-ethoxyanilino)-4-(2-hydroxy-4-isocyanoanilino)cyclobut-3-ene-1,2-dione (PubChem CID 59068196) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3-(2-ethoxyanilino)-4-(2-hydroxy-4-isocyanoanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(2-ethoxyanilino)-4-(2-hydroxy-4-isocyanoanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 59068196 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-(2-ethoxyanilino)-4-(2-hydroxy-4-isocyanoanilino)cyclobut-3-ene-1,2-dione |
| SMILES | [C-]#[N+]c1ccc(Nc2c(Nc3ccccc3OCC)c(=O)c2=O)c(O)c1 |
| InChI | InChI=1S/C19H15N3O4/c1-3-26-15-7-5-4-6-13(15)22-17-16(18(24)19(17)25)21-12-9-8-11(20-2)10-14(12)23/h4-10,21-23H,3H2,1H3 |
| InChIKey | ZBCGIBIWVCZGRJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|