About 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol
1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol (PubChem CID 59068673) has the molecular formula C11H8FNO2
and a molecular weight of 205.19 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol.
Molecular Properties
| Compound Name | 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol |
| PubChem CID | 59068673 |
| Molecular Formula | C11H8FNO2 |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol |
| SMILES | C=C(O)c1ncoc1-c1ccccc1F |
| InChI | InChI=1S/C11H8FNO2/c1-7(14)10-11(15-6-13-10)8-4-2-3-5-9(8)12/h2-6,14H,1H2 |
| InChIKey | BEHQEFGRJODTNO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol?
The IUPAC name of 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol (CID 59068673) is 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol.
What is the SMILES notation for 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol?
The canonical SMILES for 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol is C=C(O)c1ncoc1-c1ccccc1F.
What is the InChIKey of 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol?
The InChIKey is BEHQEFGRJODTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO2/c1-7(14)10-11(15-6-13-10)8-4-2-3-5-9(8)12/h2-6,14H,1H2.
What are the key properties of 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol?
1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol has a molecular weight of 205.19 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-fluorophenyl)-1,3-oxazol-4-yl]ethenol is sourced from PubChem (CID 59068673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).