About 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate
4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate (PubChem CID 59068934) has the molecular formula C17H21F3O3
and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 59068934 |
| Molecular Formula | C17H21F3O3 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCOC1CC2CC1C1C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C17H21F3O3/c1-8(17(18,19)20)16(21)23-7-22-13-6-11-5-12(13)15-10-3-2-9(4-10)14(11)15/h9-15H,1-7H2 |
| InChIKey | OGQQSTKDLWEHAI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate (CID 59068934) is 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)OCOC1CC2CC1C1C3CCC(C3)C21)C(F)(F)F.
What is the InChIKey of 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is OGQQSTKDLWEHAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F3O3/c1-8(17(18,19)20)16(21)23-7-22-13-6-11-5-12(13)15-10-3-2-9(4-10)14(11)15/h9-15H,1-7H2.
What are the key properties of 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate?
4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 330.35 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tetracyclo[6.2.1.13,6.02,7]dodecanyloxymethyl 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 59068934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).