About 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde
3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde (PubChem CID 59069016) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde |
| PubChem CID | 59069016 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde |
| SMILES | CC1(C)CC(C=O)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C12H19NO2/c1-11(2)4-10(6-14)5-12(3,7-11)8-13-9-15/h6,10H,4-5,7-8H2,1-3H3 |
| InChIKey | XMBXCLVEIKZJEJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde?
The IUPAC name of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde (CID 59069016) is 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde.
What is the SMILES notation for 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde?
The canonical SMILES for 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde is CC1(C)CC(C=O)CC(C)(CN=C=O)C1.
What is the InChIKey of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde?
The InChIKey is XMBXCLVEIKZJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-11(2)4-10(6-14)5-12(3,7-11)8-13-9-15/h6,10H,4-5,7-8H2,1-3H3.
What are the key properties of 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde?
3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde has a molecular weight of 209.29 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(isocyanatomethyl)-3,5,5-trimethylcyclohexane-1-carbaldehyde is sourced from PubChem (CID 59069016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).