C23H15F4NO3 — CID 59069376
(4S,5S)-4-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 59069376) has the molecular formula C23H15F4NO3 and a molecular weight of 429.37 g/mol. Its IUPAC name is (4S,5S)-4-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-4-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 59069376 |
| Molecular Formula | C23H15F4NO3 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (4S,5S)-4-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)phenyl]-2-(2,6-difluorophenyl)-5-methyl-4,5-dihydro-1,3-oxazole |
| SMILES | C[C@@H]1OC(c2c(F)cccc2F)=N[C@H]1c1ccc(-c2ccc3c(c2)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C23H15F4NO3/c1-12-21(28-22(29-12)20-16(24)3-2-4-17(20)25)14-7-5-13(6-8-14)15-9-10-18-19(11-15)31-23(26,27)30-18/h2-12,21H,1H3/t12-,21+/m0/s1 |
| InChIKey | DNPZIDDUSITAJN-LAJNKCICSA-N |
| XLogP | 5.86 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |