ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate

C13H19NO3 — CID 590694

IUPACethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate
SMILESCCOC(=O)c1[nH]c(C)c(C(=O)C(C)C)c1C
InChIInChI=1S/C13H19NO3/c1-6-17-13(16)11-8(4)10(9(5)14-11)12(15)7(2)3/h7,14H,6H2,1-5H3
InChIKeyGZDDIMUUXLJHOS-UHFFFAOYSA-N
MW237.30 g/mol
LogP2.65
Rot. Bonds4

About ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate

ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate (PubChem CID 590694) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate.

Molecular Properties

Compound Nameethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate
PubChem CID590694
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Nameethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate
SMILESCCOC(=O)c1[nH]c(C)c(C(=O)C(C)C)c1C
InChIInChI=1S/C13H19NO3/c1-6-17-13(16)11-8(4)10(9(5)14-11)12(15)7(2)3/h7,14H,6H2,1-5H3
InChIKeyGZDDIMUUXLJHOS-UHFFFAOYSA-N
XLogP2.65
TPSA59.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 52.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate?
The IUPAC name of ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate (CID 590694) is ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate?
The canonical SMILES for ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate is CCOC(=O)c1[nH]c(C)c(C(=O)C(C)C)c1C.
What is the InChIKey of ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate?
The InChIKey is GZDDIMUUXLJHOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-6-17-13(16)11-8(4)10(9(5)14-11)12(15)7(2)3/h7,14H,6H2,1-5H3.
What are the key properties of ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate?
ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate has a molecular weight of 237.30 g/mol, XLogP of 2.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-dimethyl-4-(2-methylpropanoyl)-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 590694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).