C22H22N6O2 — CID 59069505
N-[2-(2-cyanoethylamino)ethyl]-5-[(Z)-(5-cyano-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 59069505) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[2-(2-cyanoethylamino)ethyl]-5-[(Z)-(5-cyano-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(2-cyanoethylamino)ethyl]-5-[(Z)-(5-cyano-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59069505 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[2-(2-cyanoethylamino)ethyl]-5-[(Z)-(5-cyano-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(C#N)cc32)c(C)c1C(=O)NCCNCCC#N |
| InChI | InChI=1S/C22H22N6O2/c1-13-19(11-17-16-10-15(12-24)4-5-18(16)28-21(17)29)27-14(2)20(13)22(30)26-9-8-25-7-3-6-23/h4-5,10-11,25,27H,3,7-9H2,1-2H3,(H,26,30)(H,28,29)/b17-11- |
| InChIKey | SLHLEIQLEQDLFA-BOPFTXTBSA-N |
| XLogP | 2.23 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|