About (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide
(3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide (PubChem CID 59069931) has the molecular formula C11H24N4
and a molecular weight of 212.34 g/mol. Its IUPAC name is (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide.
Molecular Properties
| Compound Name | (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide |
| PubChem CID | 59069931 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide |
| SMILES | C/N=C(\N)N1CCC[C@H](NC(C)C)C1C |
| InChI | InChI=1S/C11H24N4/c1-8(2)14-10-6-5-7-15(9(10)3)11(12)13-4/h8-10,14H,5-7H2,1-4H3,(H2,12,13)/t9?,10-/m0/s1 |
| InChIKey | NGOGPVIGXPOKRA-AXDSSHIGSA-N |
| XLogP | 0.78 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide?
The IUPAC name of (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide (CID 59069931) is (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide.
What is the SMILES notation for (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide?
The canonical SMILES for (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide is C/N=C(\N)N1CCC[C@H](NC(C)C)C1C.
What is the InChIKey of (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide?
The InChIKey is NGOGPVIGXPOKRA-AXDSSHIGSA-N. The full InChI is InChI=1S/C11H24N4/c1-8(2)14-10-6-5-7-15(9(10)3)11(12)13-4/h8-10,14H,5-7H2,1-4H3,(H2,12,13)/t9?,10-/m0/s1.
What are the key properties of (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide?
(3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide has a molecular weight of 212.34 g/mol, XLogP of 0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N',2-dimethyl-3-(propan-2-ylamino)piperidine-1-carboximidamide is sourced from PubChem (CID 59069931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).