C9H18S — CID 59070028
(2R,3R)-2-ethyl-3,4,5-trimethylthiolane (PubChem CID 59070028) has the molecular formula C9H18S and a molecular weight of 158.31 g/mol. Its IUPAC name is (2R,3R)-2-ethyl-3,4,5-trimethylthiolane.
| Compound Name | (2R,3R)-2-ethyl-3,4,5-trimethylthiolane |
|---|---|
| PubChem CID | 59070028 |
| Molecular Formula | C9H18S |
| Molecular Weight | 158.31 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (2R,3R)-2-ethyl-3,4,5-trimethylthiolane |
| SMILES | CC[C@H]1SC(C)C(C)[C@H]1C |
| InChI | InChI=1S/C9H18S/c1-5-9-7(3)6(2)8(4)10-9/h6-9H,5H2,1-4H3/t6?,7-,8?,9-/m1/s1 |
| InChIKey | AHIZZZRJXXGXQV-SRKTWWLUSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |