About CID 59070118
CID 59070118 (PubChem CID 59070118) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol.
Molecular Properties
| Compound Name | CID 59070118 |
| PubChem CID | 59070118 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | — |
| SMILES | [CH][C@H](C=O)CNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C11H17NO2/c1-9(8-13)7-12-11(14)10-5-3-2-4-6-10/h1,8-10H,2-7H2,(H,12,14)/t9-/m0/s1 |
| InChIKey | PKLQQFVGNNTWMC-VIFPVBQESA-N |
| XLogP | 1.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze CID 59070118 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59070118?
The IUPAC name of CID 59070118 (CID 59070118) is not available.
What is the SMILES notation for CID 59070118?
The canonical SMILES for CID 59070118 is [CH][C@H](C=O)CNC(=O)C1CCCCC1.
What is the InChIKey of CID 59070118?
The InChIKey is PKLQQFVGNNTWMC-VIFPVBQESA-N. The full InChI is InChI=1S/C11H17NO2/c1-9(8-13)7-12-11(14)10-5-3-2-4-6-10/h1,8-10H,2-7H2,(H,12,14)/t9-/m0/s1.
What are the key properties of CID 59070118?
CID 59070118 has a molecular weight of 195.26 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59070118 is sourced from PubChem (CID 59070118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).