C29H38O4S — CID 59070290
4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one (PubChem CID 59070290) has the molecular formula C29H38O4S and a molecular weight of 482.69 g/mol. Its IUPAC name is 4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 59070290 |
| Molecular Formula | C29H38O4S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 4-[2-[(4aR,6aR,7S,10bR)-3,3,6a,10b-tetramethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@]3(C)COC(C)(C)O[C@@H]3CC[C@]2(C)[C@H]1CC(Sc1ccccc1)C1=CCOC1=O |
| InChI | InChI=1S/C29H38O4S/c1-19-11-12-24-28(4,15-13-25-29(24,5)18-32-27(2,3)33-25)22(19)17-23(21-14-16-31-26(21)30)34-20-9-7-6-8-10-20/h6-10,14,22-25H,1,11-13,15-18H2,2-5H3/t22-,23?,24?,25+,28+,29-/m0/s1 |
| InChIKey | GYFPOUQPKMOJDQ-KILUATMOSA-N |
| XLogP | 6.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|