C34H40O4S — CID 59070367
4-[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one (PubChem CID 59070367) has the molecular formula C34H40O4S and a molecular weight of 544.76 g/mol. Its IUPAC name is 4-[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 59070367 |
| Molecular Formula | C34H40O4S |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 4-[2-[(6aR,7S,10bR)-3,6a,10b-trimethyl-8-methylidene-3-phenyl-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]-1-phenylsulfanylethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@]3(C)COC(C)(c4ccccc4)OC3CC[C@]2(C)[C@H]1CC(Sc1ccccc1)C1=CCOC1=O |
| InChI | InChI=1S/C34H40O4S/c1-23-15-16-29-32(2,19-17-30-33(29,3)22-37-34(4,38-30)24-11-7-5-8-12-24)27(23)21-28(26-18-20-36-31(26)35)39-25-13-9-6-10-14-25/h5-14,18,27-30H,1,15-17,19-22H2,2-4H3/t27-,28?,29?,30?,32+,33-,34?/m0/s1 |
| InChIKey | JKLNNAJJVRSXNB-VCTREMSDSA-N |
| XLogP | 7.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|