About [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten
[(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten (PubChem CID 59070785) has the molecular formula C6H10NW-
and a molecular weight of 279.99 g/mol. Its IUPAC name is [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten.
Molecular Properties
| Compound Name | [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten |
| PubChem CID | 59070785 |
| Molecular Formula | C6H10NW- |
| Molecular Weight | 279.99 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten |
| SMILES | C[C@@H]1C=C[C@H]([NH-])C1.[W] |
| InChI | InChI=1S/C6H10N.W/c1-5-2-3-6(7)4-5;/h2-3,5-7H,4H2,1H3;/q-1;/t5-,6+;/m1./s1 |
| InChIKey | ISIFJICRGCSFDR-IBTYICNHSA-N |
| XLogP | 2.00 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.99 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten?
The IUPAC name of [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten (CID 59070785) is [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten.
What is the SMILES notation for [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten?
The canonical SMILES for [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten is C[C@@H]1C=C[C@H]([NH-])C1.[W].
What is the InChIKey of [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten?
The InChIKey is ISIFJICRGCSFDR-IBTYICNHSA-N. The full InChI is InChI=1S/C6H10N.W/c1-5-2-3-6(7)4-5;/h2-3,5-7H,4H2,1H3;/q-1;/t5-,6+;/m1./s1.
What are the key properties of [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten?
[(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten has a molecular weight of 279.99 g/mol, XLogP of 2.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4S)-4-methylcyclopent-2-en-1-yl]azanide;tungsten is sourced from PubChem (CID 59070785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).