C8H8Br2 — CID 59070810
1,4-bis[bromo(dideuterio)methyl]-2,3,5,6-tetradeuteriobenzene (PubChem CID 59070810) has the molecular formula C8H8Br2 and a molecular weight of 272.01 g/mol. Its IUPAC name is 1,4-bis[bromo(dideuterio)methyl]-2,3,5,6-tetradeuteriobenzene.
| Compound Name | 1,4-bis[bromo(dideuterio)methyl]-2,3,5,6-tetradeuteriobenzene |
|---|---|
| PubChem CID | 59070810 |
| Molecular Formula | C8H8Br2 |
| Molecular Weight | 272.01 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 1,4-bis[bromo(dideuterio)methyl]-2,3,5,6-tetradeuteriobenzene |
| SMILES | [2H]c1c([2H])c(C([2H])([2H])Br)c([2H])c([2H])c1C([2H])([2H])Br |
| InChI | InChI=1S/C8H8Br2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5-6H2/i1D,2D,3D,4D,5D2,6D2 |
| InChIKey | RBZMSGOBSOCYHR-MOBLDEHESA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.01 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|